About 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine
4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine (PubChem CID 155532396) has the molecular formula C19H17N3O3S2
and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine |
| PubChem CID | 155532396 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc2c(c1)c(-c1nc(N)sc1C)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O3S2/c1-12-18(21-19(20)26-12)16-11-22(17-9-8-13(25-2)10-15(16)17)27(23,24)14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,20,21) |
| InChIKey | RIQWARZLRPISBZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine?
The IUPAC name of 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine (CID 155532396) is 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine is COc1ccc2c(c1)c(-c1nc(N)sc1C)cn2S(=O)(=O)c1ccccc1.
What is the InChIKey of 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine?
The InChIKey is RIQWARZLRPISBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3S2/c1-12-18(21-19(20)26-12)16-11-22(17-9-8-13(25-2)10-15(16)17)27(23,24)14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,20,21).
What are the key properties of 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine?
4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine has a molecular weight of 399.50 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-5-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 155532396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).