C31H41Cl2N5O2 — CID 155532503
(2S)-2-amino-3-(1H-indol-3-yl)-N-[6-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]propanamide;dihydrochloride (PubChem CID 155532503) has the molecular formula C31H41Cl2N5O2 and a molecular weight of 586.61 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)-N-[6-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]propanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[6-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 155532503 |
| Molecular Formula | C31H41Cl2N5O2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[6-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]propanamide;dihydrochloride |
| SMILES | COc1ccc2nc3c(c(NCCCCCCNC(=O)[C@@H](N)Cc4c[nH]c5ccccc45)c2c1)CCCC3.Cl.Cl |
| InChI | InChI=1S/C31H39N5O2.2ClH/c1-38-22-14-15-29-25(19-22)30(24-11-5-7-13-28(24)36-29)33-16-8-2-3-9-17-34-31(37)26(32)18-21-20-35-27-12-6-4-10-23(21)27;;/h4,6,10,12,14-15,19-20,26,35H,2-3,5,7-9,11,13,16-18,32H2,1H3,(H,33,36)(H,34,37);2*1H/t26-;;/m0../s1 |
| InChIKey | MRFPTHUBOIMIHZ-ROPHLPQBSA-N |
| XLogP | 6.11 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|