About N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide
N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide (PubChem CID 155532556) has the molecular formula C21H12BrF6NO2
and a molecular weight of 504.22 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide |
| PubChem CID | 155532556 |
| Molecular Formula | C21H12BrF6NO2 |
| Molecular Weight | 504.22 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Br)c(-c2ccccc2)cc1O |
| InChI | InChI=1S/C21H12BrF6NO2/c22-17-9-16(18(30)10-15(17)11-4-2-1-3-5-11)19(31)29-14-7-12(20(23,24)25)6-13(8-14)21(26,27)28/h1-10,30H,(H,29,31) |
| InChIKey | BFCVQTRSESZUHH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.22 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide (CID 155532556) is N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide is O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Br)c(-c2ccccc2)cc1O.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide?
The InChIKey is BFCVQTRSESZUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12BrF6NO2/c22-17-9-16(18(30)10-15(17)11-4-2-1-3-5-11)19(31)29-14-7-12(20(23,24)25)6-13(8-14)21(26,27)28/h1-10,30H,(H,29,31).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide?
N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide has a molecular weight of 504.22 g/mol, XLogP of 7.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-5-bromo-2-hydroxy-4-phenylbenzamide is sourced from PubChem (CID 155532556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).