About N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine
N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine (PubChem CID 155532567) has the molecular formula C19H11F6N3O
and a molecular weight of 411.31 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine.
Molecular Properties
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine |
| PubChem CID | 155532567 |
| Molecular Formula | C19H11F6N3O |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine |
| SMILES | FC(F)(F)Oc1ccc(Nc2cc(C(F)(F)F)cc3nc4ccccc4n23)cc1 |
| InChI | InChI=1S/C19H11F6N3O/c20-18(21,22)11-9-16(26-12-5-7-13(8-6-12)29-19(23,24)25)28-15-4-2-1-3-14(15)27-17(28)10-11/h1-10,26H |
| InChIKey | LJXOHNKSBUGFRH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine?
The IUPAC name of N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine (CID 155532567) is N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine.
What is the SMILES notation for N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine?
The canonical SMILES for N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine is FC(F)(F)Oc1ccc(Nc2cc(C(F)(F)F)cc3nc4ccccc4n23)cc1.
What is the InChIKey of N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine?
The InChIKey is LJXOHNKSBUGFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F6N3O/c20-18(21,22)11-9-16(26-12-5-7-13(8-6-12)29-19(23,24)25)28-15-4-2-1-3-14(15)27-17(28)10-11/h1-10,26H.
What are the key properties of N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine?
N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine has a molecular weight of 411.31 g/mol, XLogP of 6.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyrido[1,2-a]benzimidazol-1-amine is sourced from PubChem (CID 155532567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).