C27H29N3O4 — CID 155532795
ethyl 1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-5-carboxylate (PubChem CID 155532795) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is ethyl 1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 155532795 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | ethyl 1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-5-carboxylate |
| SMILES | C/C=C/C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3)cc2C(=O)OCC)C1 |
| InChI | InChI=1S/C27H29N3O4/c1-3-9-26(31)29-17-8-10-21(19-29)30-25(27(32)33-4-2)18-24(28-30)20-13-15-23(16-14-20)34-22-11-6-5-7-12-22/h3,5-7,9,11-16,18,21H,4,8,10,17,19H2,1-2H3/b9-3+ |
| InChIKey | NPFFOXBABMAGKN-YCRREMRBSA-N |
| XLogP | 5.26 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|