C21H22ClNO4 — CID 155532815
[(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 2-chloropyridine-3-carboxylate (PubChem CID 155532815) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is [(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 2-chloropyridine-3-carboxylate.
| Compound Name | [(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 155532815 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [(4R,5E,8S,9S)-5-methyl-11-oxo-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),5-dien-4-yl] 2-chloropyridine-3-carboxylate |
| SMILES | C=C(C)[C@@H]1C/C=C(\C)[C@H](OC(=O)c2cccnc2Cl)CCC2=C[C@@H]1OC2=O |
| InChI | InChI=1S/C21H22ClNO4/c1-12(2)15-8-6-13(3)17(9-7-14-11-18(15)27-20(14)24)26-21(25)16-5-4-10-23-19(16)22/h4-6,10-11,15,17-18H,1,7-9H2,2-3H3/b13-6+/t15-,17+,18-/m0/s1 |
| InChIKey | RDFTZGXDOSMZMN-UFOLEPLCSA-N |
| XLogP | 4.43 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|