C21H21N5O — CID 155532849
2-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 155532849) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155532849 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccccc1-n1cc(CN2CCc3c([nH]c4ccccc34)C2)nn1 |
| InChI | InChI=1S/C21H21N5O/c1-27-21-9-5-4-8-20(21)26-13-15(23-24-26)12-25-11-10-17-16-6-2-3-7-18(16)22-19(17)14-25/h2-9,13,22H,10-12,14H2,1H3 |
| InChIKey | ZHBPMZFZRKOKJQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|