About 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol
2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol (PubChem CID 15553288) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol |
| PubChem CID | 15553288 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol |
| SMILES | Nc1ccnc2c(NCCO)cnn12 |
| InChI | InChI=1S/C8H11N5O/c9-7-1-2-11-8-6(10-3-4-14)5-12-13(7)8/h1-2,5,10,14H,3-4,9H2 |
| InChIKey | HARBPHQCTIDSBX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol?
The IUPAC name of 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol (CID 15553288) is 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol.
What is the SMILES notation for 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol?
The canonical SMILES for 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol is Nc1ccnc2c(NCCO)cnn12.
What is the InChIKey of 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol?
The InChIKey is HARBPHQCTIDSBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c9-7-1-2-11-8-6(10-3-4-14)5-12-13(7)8/h1-2,5,10,14H,3-4,9H2.
What are the key properties of 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol?
2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol has a molecular weight of 193.21 g/mol, XLogP of -0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-aminopyrazolo[1,5-a]pyrimidin-3-yl)amino]ethanol is sourced from PubChem (CID 15553288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).