About 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole
2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole (PubChem CID 155532885) has the molecular formula C15H11N5S
and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole |
| PubChem CID | 155532885 |
| Molecular Formula | C15H11N5S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole |
| SMILES | Cc1ccc(-c2nnnn2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H11N5S/c1-10-6-8-11(9-7-10)14-17-18-19-20(14)15-16-12-4-2-3-5-13(12)21-15/h2-9H,1H3 |
| InChIKey | XQLJMUXPNXGQDC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole?
The IUPAC name of 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole (CID 155532885) is 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole.
What is the SMILES notation for 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole?
The canonical SMILES for 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole is Cc1ccc(-c2nnnn2-c2nc3ccccc3s2)cc1.
What is the InChIKey of 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole?
The InChIKey is XQLJMUXPNXGQDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N5S/c1-10-6-8-11(9-7-10)14-17-18-19-20(14)15-16-12-4-2-3-5-13(12)21-15/h2-9H,1H3.
What are the key properties of 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole?
2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole has a molecular weight of 293.36 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-methylphenyl)tetrazol-1-yl]-1,3-benzothiazole is sourced from PubChem (CID 155532885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).