About (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine
(NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine (PubChem CID 15553298) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine |
| PubChem CID | 15553298 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine |
| SMILES | CC(/C=N/O)=C\CC(C)CCCC(C)C |
| InChI | InChI=1S/C13H25NO/c1-11(2)6-5-7-12(3)8-9-13(4)10-14-15/h9-12,15H,5-8H2,1-4H3/b13-9+,14-10+ |
| InChIKey | UQEINYVOJAFMLB-UTLPMFLDSA-N |
| XLogP | 4.25 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine?
The IUPAC name of (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine (CID 15553298) is (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine is CC(/C=N/O)=C\CC(C)CCCC(C)C.
What is the InChIKey of (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine?
The InChIKey is UQEINYVOJAFMLB-UTLPMFLDSA-N. The full InChI is InChI=1S/C13H25NO/c1-11(2)6-5-7-12(3)8-9-13(4)10-14-15/h9-12,15H,5-8H2,1-4H3/b13-9+,14-10+.
What are the key properties of (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine?
(NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine has a molecular weight of 211.35 g/mol, XLogP of 4.25, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(E)-2,5,9-trimethyldec-2-enylidene]hydroxylamine is sourced from PubChem (CID 15553298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).