About 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate
2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate (PubChem CID 155533038) has the molecular formula C19H18N2O6
and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate |
| PubChem CID | 155533038 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3ccc(C(=O)OCCO)cc3)nc2c1 |
| InChI | InChI=1S/C19H18N2O6/c1-25-13-9-14-16(15(10-13)26-2)18(23)21-17(20-14)11-3-5-12(6-4-11)19(24)27-8-7-22/h3-6,9-10,22H,7-8H2,1-2H3,(H,20,21,23) |
| InChIKey | IPQGDQZRGREEJU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate?
The IUPAC name of 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate (CID 155533038) is 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate.
What is the SMILES notation for 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate?
The canonical SMILES for 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate is COc1cc(OC)c2c(=O)[nH]c(-c3ccc(C(=O)OCCO)cc3)nc2c1.
What is the InChIKey of 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate?
The InChIKey is IPQGDQZRGREEJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O6/c1-25-13-9-14-16(15(10-13)26-2)18(23)21-17(20-14)11-3-5-12(6-4-11)19(24)27-8-7-22/h3-6,9-10,22H,7-8H2,1-2H3,(H,20,21,23).
What are the key properties of 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate?
2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate has a molecular weight of 370.36 g/mol, XLogP of 1.76, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)benzoate is sourced from PubChem (CID 155533038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).