About 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole
2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole (PubChem CID 155533288) has the molecular formula C33H23N5O
and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole |
| PubChem CID | 155533288 |
| Molecular Formula | C33H23N5O |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole |
| SMILES | c1ccc2c(-c3nnc(-c4ccc(C(c5c[nH]c6ccccc56)c5c[nH]c6ccccc56)cc4)o3)c[nH]c2c1 |
| InChI | InChI=1S/C33H23N5O/c1-4-10-28-22(7-1)25(17-34-28)31(26-18-35-29-11-5-2-8-23(26)29)20-13-15-21(16-14-20)32-37-38-33(39-32)27-19-36-30-12-6-3-9-24(27)30/h1-19,31,34-36H |
| InChIKey | JXMWRBXTAODCFJ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole (CID 155533288) is 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole is c1ccc2c(-c3nnc(-c4ccc(C(c5c[nH]c6ccccc56)c5c[nH]c6ccccc56)cc4)o3)c[nH]c2c1.
What is the InChIKey of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole?
The InChIKey is JXMWRBXTAODCFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H23N5O/c1-4-10-28-22(7-1)25(17-34-28)31(26-18-35-29-11-5-2-8-23(26)29)20-13-15-21(16-14-20)32-37-38-33(39-32)27-19-36-30-12-6-3-9-24(27)30/h1-19,31,34-36H.
What are the key properties of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole?
2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole has a molecular weight of 505.58 g/mol, XLogP of 8.03, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 155533288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).