C33H40ClF2N7O3 — CID 155533308
(2R)-5-(diaminomethylideneamino)-N-[(3,5-difluorophenyl)methyl]-2-[4-[[2-[2-(3-methylbutoxy)phenyl]phenoxy]methyl]triazol-1-yl]pentanamide;hydrochloride (PubChem CID 155533308) has the molecular formula C33H40ClF2N7O3 and a molecular weight of 656.18 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-N-[(3,5-difluorophenyl)methyl]-2-[4-[[2-[2-(3-methylbutoxy)phenyl]phenoxy]methyl]triazol-1-yl]pentanamide;hydrochloride.
| Compound Name | (2R)-5-(diaminomethylideneamino)-N-[(3,5-difluorophenyl)methyl]-2-[4-[[2-[2-(3-methylbutoxy)phenyl]phenoxy]methyl]triazol-1-yl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 155533308 |
| Molecular Formula | C33H40ClF2N7O3 |
| Molecular Weight | 656.18 g/mol |
| Exact Mass | 655.28 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-N-[(3,5-difluorophenyl)methyl]-2-[4-[[2-[2-(3-methylbutoxy)phenyl]phenoxy]methyl]triazol-1-yl]pentanamide;hydrochloride |
| SMILES | CC(C)CCOc1ccccc1-c1ccccc1OCc1cn([C@H](CCCN=C(N)N)C(=O)NCc2cc(F)cc(F)c2)nn1.Cl |
| InChI | InChI=1S/C33H39F2N7O3.ClH/c1-22(2)13-15-44-30-11-5-3-8-27(30)28-9-4-6-12-31(28)45-21-26-20-42(41-40-26)29(10-7-14-38-33(36)37)32(43)39-19-23-16-24(34)18-25(35)17-23;/h3-6,8-9,11-12,16-18,20,22,29H,7,10,13-15,19,21H2,1-2H3,(H,39,43)(H4,36,37,38);1H/t29-;/m1./s1 |
| InChIKey | JVQQMPSKOIXXJN-XXIQNXCHSA-N |
| XLogP | 5.56 |
| TPSA | 142.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.18 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|