C22H30O3 — CID 155533392
(6S,8R,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-6-prop-2-enyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 155533392) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-6-prop-2-enyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6S,8R,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-6-prop-2-enyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 155533392 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-6-prop-2-enyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=CC[C@H]1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)CCC(=O)C(O)=C12 |
| InChI | InChI=1S/C22H30O3/c1-4-5-13-12-14-15-6-7-18(24)21(15,2)10-8-16(14)22(3)11-9-17(23)20(25)19(13)22/h4,13-16,25H,1,5-12H2,2-3H3/t13-,14-,15-,16-,21-,22+/m0/s1 |
| InChIKey | BWGGUQNJIMTEGI-FCAWPTKZSA-N |
| XLogP | 4.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|