About 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine
5-phenylpyrido[3,4-g]quinazoline-2,10-diamine (PubChem CID 155533460) has the molecular formula C17H13N5
and a molecular weight of 287.33 g/mol. Its IUPAC name is 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine.
Molecular Properties
| Compound Name | 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine |
| PubChem CID | 155533460 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine |
| SMILES | Nc1ncc2c(-c3ccccc3)c3cnccc3c(N)c2n1 |
| InChI | InChI=1S/C17H13N5/c18-15-11-6-7-20-8-12(11)14(10-4-2-1-3-5-10)13-9-21-17(19)22-16(13)15/h1-9H,18H2,(H2,19,21,22) |
| InChIKey | UAWXKKPUTNNTOZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine?
The IUPAC name of 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine (CID 155533460) is 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine.
What is the SMILES notation for 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine?
The canonical SMILES for 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine is Nc1ncc2c(-c3ccccc3)c3cnccc3c(N)c2n1.
What is the InChIKey of 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine?
The InChIKey is UAWXKKPUTNNTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5/c18-15-11-6-7-20-8-12(11)14(10-4-2-1-3-5-10)13-9-21-17(19)22-16(13)15/h1-9H,18H2,(H2,19,21,22).
What are the key properties of 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine?
5-phenylpyrido[3,4-g]quinazoline-2,10-diamine has a molecular weight of 287.33 g/mol, XLogP of 3.01, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpyrido[3,4-g]quinazoline-2,10-diamine is sourced from PubChem (CID 155533460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).