C16H17ClN4O — CID 155533537
5-(4-chlorophenyl)-2-pentyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 155533537) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-pentyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(4-chlorophenyl)-2-pentyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 155533537 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2-pentyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCCCc1nc2nc(-c3ccc(Cl)cc3)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C16H17ClN4O/c1-2-3-4-5-14-19-16-18-13(10-15(22)21(16)20-14)11-6-8-12(17)9-7-11/h6-10H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | IFFXCOZZZIFOAZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|