About N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide
N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide (PubChem CID 155533921) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide.
Molecular Properties
| Compound Name | N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide |
| PubChem CID | 155533921 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide |
| SMILES | Cc1noc(C)c1Cn1cc(NC(=O)c2cccc(O)c2)cn1 |
| InChI | InChI=1S/C16H16N4O3/c1-10-15(11(2)23-19-10)9-20-8-13(7-17-20)18-16(22)12-4-3-5-14(21)6-12/h3-8,21H,9H2,1-2H3,(H,18,22) |
| InChIKey | CCJKRHNWTIPHAC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide?
The IUPAC name of N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide (CID 155533921) is N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide.
What is the SMILES notation for N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide?
The canonical SMILES for N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide is Cc1noc(C)c1Cn1cc(NC(=O)c2cccc(O)c2)cn1.
What is the InChIKey of N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide?
The InChIKey is CCJKRHNWTIPHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3/c1-10-15(11(2)23-19-10)9-20-8-13(7-17-20)18-16(22)12-4-3-5-14(21)6-12/h3-8,21H,9H2,1-2H3,(H,18,22).
What are the key properties of N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide?
N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide has a molecular weight of 312.33 g/mol, XLogP of 2.49, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-hydroxybenzamide is sourced from PubChem (CID 155533921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).