C31H28F3IN6O6 — CID 155533957
N-[3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 155533957) has the molecular formula C31H28F3IN6O6 and a molecular weight of 764.50 g/mol. Its IUPAC name is N-[3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 155533957 |
| Molecular Formula | C31H28F3IN6O6 |
| Molecular Weight | 764.50 g/mol |
| Exact Mass | 764.11 |
| IUPAC Name | N-[3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCNCCCONC(=O)c4ccc(F)c(F)c4Nc4ccc(I)cc4F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H28F3IN6O6/c32-19-7-6-18(27(26(19)34)38-21-8-5-16(35)15-20(21)33)28(43)40-47-14-2-11-36-12-13-37-22-4-1-3-17-25(22)31(46)41(30(17)45)23-9-10-24(42)39-29(23)44/h1,3-8,15,23,36-38H,2,9-14H2,(H,40,43)(H,39,42,44) |
| InChIKey | RRMNATGTRRMSTA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|