C24H29FN2O7 — CID 155534077
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 2-(5-fluoro-2,4-dioxo-3-propylpyrimidin-1-yl)acetate (PubChem CID 155534077) has the molecular formula C24H29FN2O7 and a molecular weight of 476.50 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 2-(5-fluoro-2,4-dioxo-3-propylpyrimidin-1-yl)acetate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 2-(5-fluoro-2,4-dioxo-3-propylpyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 155534077 |
| Molecular Formula | C24H29FN2O7 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 2-(5-fluoro-2,4-dioxo-3-propylpyrimidin-1-yl)acetate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)Cn1cc(F)c(=O)n(CCC)c1=O)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C24H29FN2O7/c1-4-10-27-21(29)17(25)11-26(23(27)31)12-18(28)32-13-15-6-5-9-24(3)20(34-24)19-16(8-7-15)14(2)22(30)33-19/h6,11,16,19-20H,2,4-5,7-10,12-13H2,1,3H3/b15-6+/t16-,19-,20-,24+/m0/s1 |
| InChIKey | KFYNWLATSBTQIS-OPXDBTQMSA-N |
| XLogP | 1.86 |
| TPSA | 109.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|