C20H22O4 — CID 155534125
(1R,11R,12R,13R)-11-methoxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione (PubChem CID 155534125) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (1R,11R,12R,13R)-11-methoxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione.
| Compound Name | (1R,11R,12R,13R)-11-methoxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
|---|---|
| PubChem CID | 155534125 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (1R,11R,12R,13R)-11-methoxy-8,16-dimethyl-14-oxapentacyclo[11.2.2.19,12.01,11.04,10]octadeca-4,7,9-triene-6,15-dione |
| SMILES | CO[C@@]12c3c4cc(=O)cc(C)c3C[C@@H]1[C@H]1CC(C)[C@@]2(CC4)C(=O)O1 |
| InChI | InChI=1S/C20H22O4/c1-10-6-13(21)8-12-4-5-19-11(2)7-16(24-18(19)22)15-9-14(10)17(12)20(15,19)23-3/h6,8,11,15-16H,4-5,7,9H2,1-3H3/t11?,15-,16-,19+,20-/m1/s1 |
| InChIKey | PRNZPPREKVOZOE-BVWZTOKYSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |