C29H34O7 — CID 155534136
[(1S,2R,3aR,5E,12E,13aS)-3a-acetyloxy-2,5,8,8,12-pentamethyl-4,9,11-trioxo-2,3,7,13a-tetrahydro-1H-cyclopenta[12]annulen-1-yl] benzoate (PubChem CID 155534136) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is [(1S,2R,3aR,5E,12E,13aS)-3a-acetyloxy-2,5,8,8,12-pentamethyl-4,9,11-trioxo-2,3,7,13a-tetrahydro-1H-cyclopenta[12]annulen-1-yl] benzoate.
| Compound Name | [(1S,2R,3aR,5E,12E,13aS)-3a-acetyloxy-2,5,8,8,12-pentamethyl-4,9,11-trioxo-2,3,7,13a-tetrahydro-1H-cyclopenta[12]annulen-1-yl] benzoate |
|---|---|
| PubChem CID | 155534136 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [(1S,2R,3aR,5E,12E,13aS)-3a-acetyloxy-2,5,8,8,12-pentamethyl-4,9,11-trioxo-2,3,7,13a-tetrahydro-1H-cyclopenta[12]annulen-1-yl] benzoate |
| SMILES | CC(=O)O[C@]12C[C@@H](C)[C@H](OC(=O)c3ccccc3)[C@@H]1/C=C(\C)C(=O)CC(=O)C(C)(C)C/C=C(\C)C2=O |
| InChI | InChI=1S/C29H34O7/c1-17-12-13-28(5,6)24(32)15-23(31)18(2)14-22-25(35-27(34)21-10-8-7-9-11-21)19(3)16-29(22,26(17)33)36-20(4)30/h7-12,14,19,22,25H,13,15-16H2,1-6H3/b17-12+,18-14+/t19-,22+,25+,29-/m1/s1 |
| InChIKey | UUCGCNABLPLWMM-DVIPKXGJSA-N |
| XLogP | 4.59 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|