About N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide
N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 155534255) has the molecular formula C10H10N4O2
and a molecular weight of 218.22 g/mol. Its IUPAC name is N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide.
Molecular Properties
| Compound Name | N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
| PubChem CID | 155534255 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cc1nc(-c2ccc(C(=O)NO)cc2)n[nH]1 |
| InChI | InChI=1S/C10H10N4O2/c1-6-11-9(13-12-6)7-2-4-8(5-3-7)10(15)14-16/h2-5,16H,1H3,(H,14,15)(H,11,12,13) |
| InChIKey | ZUZRIDRMGJDWEZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide?
The IUPAC name of N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide (CID 155534255) is N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide.
What is the SMILES notation for N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide?
The canonical SMILES for N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide is Cc1nc(-c2ccc(C(=O)NO)cc2)n[nH]1.
What is the InChIKey of N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide?
The InChIKey is ZUZRIDRMGJDWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2/c1-6-11-9(13-12-6)7-2-4-8(5-3-7)10(15)14-16/h2-5,16H,1H3,(H,14,15)(H,11,12,13).
What are the key properties of N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide?
N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide has a molecular weight of 218.22 g/mol, XLogP of 0.90, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-4-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide is sourced from PubChem (CID 155534255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).