C24H33N7O5 — CID 155534264
(3R,4R,5S)-4-acetamido-5-amino-N-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]-3-pentan-3-yloxycyclohexene-1-carboxamide (PubChem CID 155534264) has the molecular formula C24H33N7O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-amino-N-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]-3-pentan-3-yloxycyclohexene-1-carboxamide.
| Compound Name | (3R,4R,5S)-4-acetamido-5-amino-N-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]-3-pentan-3-yloxycyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 155534264 |
| Molecular Formula | C24H33N7O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-amino-N-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]-3-pentan-3-yloxycyclohexene-1-carboxamide |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)NCc2cn(Cc3cccc([N+](=O)[O-])c3)nn2)C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C24H33N7O5/c1-4-20(5-2)36-22-11-17(10-21(25)23(22)27-15(3)32)24(33)26-12-18-14-30(29-28-18)13-16-7-6-8-19(9-16)31(34)35/h6-9,11,14,20-23H,4-5,10,12-13,25H2,1-3H3,(H,26,33)(H,27,32)/t21-,22+,23+/m0/s1 |
| InChIKey | YZZKFHVPCJVMPM-YTFSRNRJSA-N |
| XLogP | 1.59 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|