C34H44F3N7O6S — CID 155534310
(4-benzylpiperidin-4-yl) N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 155534310) has the molecular formula C34H44F3N7O6S and a molecular weight of 735.83 g/mol. Its IUPAC name is (4-benzylpiperidin-4-yl) N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-benzylpiperidin-4-yl) N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155534310 |
| Molecular Formula | C34H44F3N7O6S |
| Molecular Weight | 735.83 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | (4-benzylpiperidin-4-yl) N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCNCC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nc2ccccc2s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H43N7O4S.C2HF3O2/c1-21(2)19-25(39-31(42)43-32(14-17-35-18-15-32)20-22-9-4-3-5-10-22)28(41)37-24(12-8-16-36-30(33)34)27(40)29-38-23-11-6-7-13-26(23)44-29;3-2(4,5)1(6)7/h3-7,9-11,13,21,24-25,35H,8,12,14-20H2,1-2H3,(H,37,41)(H,39,42)(H4,33,34,36);(H,6,7)/t24-,25-;/m0./s1 |
| InChIKey | MBIXNDGDZZBCGB-DKIIUIKKSA-N |
| XLogP | 4.16 |
| TPSA | 211.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.83 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|