About 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one
2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 155534312) has the molecular formula C27H31N3OS
and a molecular weight of 445.63 g/mol. Its IUPAC name is 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 155534312 |
| Molecular Formula | C27H31N3OS |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCCCCN2CCC(Cc3ccccc3)CC2)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C27H31N3OS/c31-27-26-25(22-11-6-7-12-23(22)32-26)28-24(29-27)13-5-2-8-16-30-17-14-21(15-18-30)19-20-9-3-1-4-10-20/h1,3-4,6-7,9-12,21H,2,5,8,13-19H2,(H,28,29,31) |
| InChIKey | ZDFFFXPKXNTHTO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (CID 155534312) is 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one is O=c1[nH]c(CCCCCN2CCC(Cc3ccccc3)CC2)nc2c1sc1ccccc12.
What is the InChIKey of 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
The InChIKey is ZDFFFXPKXNTHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N3OS/c31-27-26-25(22-11-6-7-12-23(22)32-26)28-24(29-27)13-5-2-8-16-30-17-14-21(15-18-30)19-20-9-3-1-4-10-20/h1,3-4,6-7,9-12,21H,2,5,8,13-19H2,(H,28,29,31).
What are the key properties of 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one?
2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one has a molecular weight of 445.63 g/mol, XLogP of 5.81, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-benzylpiperidin-1-yl)pentyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 155534312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).