C26H22FN3O — CID 155534457
(E)-1-[4-[2-[1-[(3-fluorophenyl)methyl]triazol-4-yl]ethyl]phenyl]-3-phenylprop-2-en-1-one (PubChem CID 155534457) has the molecular formula C26H22FN3O and a molecular weight of 411.48 g/mol. Its IUPAC name is (E)-1-[4-[2-[1-[(3-fluorophenyl)methyl]triazol-4-yl]ethyl]phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-[1-[(3-fluorophenyl)methyl]triazol-4-yl]ethyl]phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 155534457 |
| Molecular Formula | C26H22FN3O |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (E)-1-[4-[2-[1-[(3-fluorophenyl)methyl]triazol-4-yl]ethyl]phenyl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(CCc2cn(Cc3cccc(F)c3)nn2)cc1 |
| InChI | InChI=1S/C26H22FN3O/c27-24-8-4-7-22(17-24)18-30-19-25(28-29-30)15-11-21-9-13-23(14-10-21)26(31)16-12-20-5-2-1-3-6-20/h1-10,12-14,16-17,19H,11,15,18H2/b16-12+ |
| InChIKey | GBJQZKOSXHXBSB-FOWTUZBSSA-N |
| XLogP | 5.15 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|