C20H28O4 — CID 155534578
(2S,4aS,4bS,5R,7R,10aS)-7-ethenyl-2,5-dihydroxy-1,1,4a,7-tetramethyl-3,4b,5,6,10,10a-hexahydro-2H-phenanthrene-4,9-dione (PubChem CID 155534578) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S,4aS,4bS,5R,7R,10aS)-7-ethenyl-2,5-dihydroxy-1,1,4a,7-tetramethyl-3,4b,5,6,10,10a-hexahydro-2H-phenanthrene-4,9-dione.
| Compound Name | (2S,4aS,4bS,5R,7R,10aS)-7-ethenyl-2,5-dihydroxy-1,1,4a,7-tetramethyl-3,4b,5,6,10,10a-hexahydro-2H-phenanthrene-4,9-dione |
|---|---|
| PubChem CID | 155534578 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (2S,4aS,4bS,5R,7R,10aS)-7-ethenyl-2,5-dihydroxy-1,1,4a,7-tetramethyl-3,4b,5,6,10,10a-hexahydro-2H-phenanthrene-4,9-dione |
| SMILES | C=C[C@]1(C)C=C2C(=O)C[C@H]3C(C)(C)[C@@H](O)CC(=O)[C@]3(C)[C@H]2[C@H](O)C1 |
| InChI | InChI=1S/C20H28O4/c1-6-19(4)9-11-12(21)7-14-18(2,3)15(23)8-16(24)20(14,5)17(11)13(22)10-19/h6,9,13-15,17,22-23H,1,7-8,10H2,2-5H3/t13-,14+,15+,17-,19-,20-/m1/s1 |
| InChIKey | SFTRIKRIJQCBGG-SJKBCMPFSA-N |
| XLogP | 2.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|