About propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate
propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate (PubChem CID 155534761) has the molecular formula C15H13FO6
and a molecular weight of 308.26 g/mol. Its IUPAC name is propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate |
| PubChem CID | 155534761 |
| Molecular Formula | C15H13FO6 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate |
| SMILES | CC(C)OC(=O)c1cc(O)c(=O)c2c(O)c(O)c(F)cc2c1 |
| InChI | InChI=1S/C15H13FO6/c1-6(2)22-15(21)8-3-7-4-9(16)12(18)14(20)11(7)13(19)10(17)5-8/h3-6,18,20H,1-2H3,(H,17,19) |
| InChIKey | SRLJPPCSRBEALM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate?
The IUPAC name of propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate (CID 155534761) is propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate.
What is the SMILES notation for propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate?
The canonical SMILES for propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate is CC(C)OC(=O)c1cc(O)c(=O)c2c(O)c(O)c(F)cc2c1.
What is the InChIKey of propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate?
The InChIKey is SRLJPPCSRBEALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FO6/c1-6(2)22-15(21)8-3-7-4-9(16)12(18)14(20)11(7)13(19)10(17)5-8/h3-6,18,20H,1-2H3,(H,17,19).
What are the key properties of propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate?
propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate has a molecular weight of 308.26 g/mol, XLogP of 2.02, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-fluoro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate is sourced from PubChem (CID 155534761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).