About 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one
2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one (PubChem CID 155534820) has the molecular formula C19H11ClO3S
and a molecular weight of 354.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one |
| PubChem CID | 155534820 |
| Molecular Formula | C19H11ClO3S |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one |
| SMILES | O=C1C=C(c2cccc(Cl)c2)S(=O)(=O)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C19H11ClO3S/c20-14-6-3-5-13(10-14)18-11-17(21)16-9-8-12-4-1-2-7-15(12)19(16)24(18,22)23/h1-11H |
| InChIKey | MPLMSQAXEVRMQO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one?
The IUPAC name of 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one (CID 155534820) is 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one.
What is the SMILES notation for 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one?
The canonical SMILES for 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one is O=C1C=C(c2cccc(Cl)c2)S(=O)(=O)c2c1ccc1ccccc21.
What is the InChIKey of 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one?
The InChIKey is MPLMSQAXEVRMQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClO3S/c20-14-6-3-5-13(10-14)18-11-17(21)16-9-8-12-4-1-2-7-15(12)19(16)24(18,22)23/h1-11H.
What are the key properties of 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one?
2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one has a molecular weight of 354.81 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-1,1-dioxobenzo[h]thiochromen-4-one is sourced from PubChem (CID 155534820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).