C10H6ClF3N4OS2 — CID 155534930
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea (PubChem CID 155534930) has the molecular formula C10H6ClF3N4OS2 and a molecular weight of 354.77 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 155534930 |
| Molecular Formula | C10H6ClF3N4OS2 |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C10H6ClF3N4OS2/c11-6-2-1-4(3-5(6)10(12,13)14)15-7(19)16-8-17-18-9(20)21-8/h1-3H,(H,18,20)(H2,15,16,17,19) |
| InChIKey | CATRHWNLGHUOPY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|