C49H96N14O — CID 155535027
1,1-bis[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea (PubChem CID 155535027) has the molecular formula C49H96N14O and a molecular weight of 897.40 g/mol. Its IUPAC name is 1,1-bis[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea.
| Compound Name | 1,1-bis[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea |
|---|---|
| PubChem CID | 155535027 |
| Molecular Formula | C49H96N14O |
| Molecular Weight | 897.40 g/mol |
| Exact Mass | 896.79 |
| IUPAC Name | 1,1-bis[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3,3-bis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea |
| SMILES | N/C(=N\CC1CC1)NCCCCCCCCN(CCCCCCCCN/C(N)=N/CC1CC1)C(=O)N(CCCCCCN/C(N)=N/CC1CC1)CCCCCCN/C(N)=N/CC1CC1 |
| InChI | InChI=1S/C49H96N14O/c50-45(58-37-41-21-22-41)54-29-13-5-1-3-9-17-33-62(34-18-10-4-2-6-14-30-55-46(51)59-38-42-23-24-42)49(64)63(35-19-11-7-15-31-56-47(52)60-39-43-25-26-43)36-20-12-8-16-32-57-48(53)61-40-44-27-28-44/h41-44H,1-40H2,(H3,50,54,58)(H3,51,55,59)(H3,52,56,60)(H3,53,57,61) |
| InChIKey | GTROZGCYPDDMKY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 225.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|