C30H44O5 — CID 155535066
(4E,6E,8S,9S,10Z,12Z,14E,16R,17S,18S,19E,21E)-8,16-dihydroxy-18-methoxy-6,9,11,13,17,19-hexamethyl-1-oxacyclotetracosa-4,6,10,12,14,19,21-heptaen-2-one (PubChem CID 155535066) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (4E,6E,8S,9S,10Z,12Z,14E,16R,17S,18S,19E,21E)-8,16-dihydroxy-18-methoxy-6,9,11,13,17,19-hexamethyl-1-oxacyclotetracosa-4,6,10,12,14,19,21-heptaen-2-one.
| Compound Name | (4E,6E,8S,9S,10Z,12Z,14E,16R,17S,18S,19E,21E)-8,16-dihydroxy-18-methoxy-6,9,11,13,17,19-hexamethyl-1-oxacyclotetracosa-4,6,10,12,14,19,21-heptaen-2-one |
|---|---|
| PubChem CID | 155535066 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (4E,6E,8S,9S,10Z,12Z,14E,16R,17S,18S,19E,21E)-8,16-dihydroxy-18-methoxy-6,9,11,13,17,19-hexamethyl-1-oxacyclotetracosa-4,6,10,12,14,19,21-heptaen-2-one |
| SMILES | CO[C@@H]1/C(C)=C/C=C/CCOC(=O)C/C=C/C(C)=C/[C@@H](O)[C@@H](C)/C=C(C)\C=C(C)/C=C/[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C30H44O5/c1-21-12-11-14-29(33)35-17-10-8-9-13-24(4)30(34-7)26(6)27(31)16-15-22(2)18-23(3)19-25(5)28(32)20-21/h8-9,11-13,15-16,18-20,25-28,30-32H,10,14,17H2,1-7H3/b9-8+,12-11+,16-15+,21-20+,22-18-,23-19-,24-13+/t25-,26-,27+,28+,30+/m0/s1 |
| InChIKey | YEYUXRUNTCBNSI-GNVMUULTSA-N |
| XLogP | 5.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |