C21H31N5O4 — CID 155535353
(3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-methyl-N-pyridin-2-yldiazinane-3-carboxamide (PubChem CID 155535353) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-methyl-N-pyridin-2-yldiazinane-3-carboxamide.
| Compound Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-methyl-N-pyridin-2-yldiazinane-3-carboxamide |
|---|---|
| PubChem CID | 155535353 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-methyl-N-pyridin-2-yldiazinane-3-carboxamide |
| SMILES | CN(C(=O)[C@@H]1CCCNN1C(=O)[C@H](CC1CCCC1)CN(O)C=O)c1ccccn1 |
| InChI | InChI=1S/C21H31N5O4/c1-24(19-10-4-5-11-22-19)21(29)18-9-6-12-23-26(18)20(28)17(14-25(30)15-27)13-16-7-2-3-8-16/h4-5,10-11,15-18,23,30H,2-3,6-9,12-14H2,1H3/t17-,18+/m1/s1 |
| InChIKey | GRUPNIKEBQWHIV-MSOLQXFVSA-N |
| XLogP | 1.58 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|