About 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide
3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide (PubChem CID 155535519) has the molecular formula C17H14ClN3O5
and a molecular weight of 375.77 g/mol. Its IUPAC name is 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide.
Molecular Properties
| Compound Name | 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide |
| PubChem CID | 155535519 |
| Molecular Formula | C17H14ClN3O5 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NO)cc1OCc1noc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H14ClN3O5/c1-24-13-6-5-10(16(22)20-23)8-14(13)25-9-15-19-17(26-21-15)11-3-2-4-12(18)7-11/h2-8,23H,9H2,1H3,(H,20,22) |
| InChIKey | VGMMCWHMDQYMOS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide?
The IUPAC name of 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide (CID 155535519) is 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide.
What is the SMILES notation for 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide?
The canonical SMILES for 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide is COc1ccc(C(=O)NO)cc1OCc1noc(-c2cccc(Cl)c2)n1.
What is the InChIKey of 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide?
The InChIKey is VGMMCWHMDQYMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O5/c1-24-13-6-5-10(16(22)20-23)8-14(13)25-9-15-19-17(26-21-15)11-3-2-4-12(18)7-11/h2-8,23H,9H2,1H3,(H,20,22).
What are the key properties of 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide?
3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide has a molecular weight of 375.77 g/mol, XLogP of 3.10, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]methoxy]-N-hydroxy-4-methoxybenzamide is sourced from PubChem (CID 155535519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).