C27H36O5 — CID 155535570
7-[[(1R,4aR,6S,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-8-ethyl-6-methoxychromen-2-one (PubChem CID 155535570) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is 7-[[(1R,4aR,6S,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-8-ethyl-6-methoxychromen-2-one.
| Compound Name | 7-[[(1R,4aR,6S,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-8-ethyl-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 155535570 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 7-[[(1R,4aR,6S,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-8-ethyl-6-methoxychromen-2-one |
| SMILES | CCc1c(OC[C@@H]2C(C)=CC[C@H]3C(C)(C)[C@@H](O)CC[C@]23C)c(OC)cc2ccc(=O)oc12 |
| InChI | InChI=1S/C27H36O5/c1-7-18-24-17(9-11-23(29)32-24)14-20(30-6)25(18)31-15-19-16(2)8-10-21-26(3,4)22(28)12-13-27(19,21)5/h8-9,11,14,19,21-22,28H,7,10,12-13,15H2,1-6H3/t19-,21+,22+,27-/m1/s1 |
| InChIKey | IGIDDRTZOQIMES-DOTYIUQFSA-N |
| XLogP | 5.51 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|