C36H37N7O6 — CID 155535769
7-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentyl]-6-methoxy-4-methyl-9H-pyrimido[4,5-b]indole-2-carboxamide (PubChem CID 155535769) has the molecular formula C36H37N7O6 and a molecular weight of 663.74 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentyl]-6-methoxy-4-methyl-9H-pyrimido[4,5-b]indole-2-carboxamide.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentyl]-6-methoxy-4-methyl-9H-pyrimido[4,5-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 155535769 |
| Molecular Formula | C36H37N7O6 |
| Molecular Weight | 663.74 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pentyl]-6-methoxy-4-methyl-9H-pyrimido[4,5-b]indole-2-carboxamide |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1nc(C(=O)NCCCCCc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)nc(C)c12 |
| InChI | InChI=1S/C36H37N7O6/c1-18-31-23-16-28(48-4)24(30-19(2)42-49-20(30)3)15-26(23)39-32(31)41-33(38-18)35(46)37-14-7-5-6-9-21-10-8-11-22-25(21)17-43(36(22)47)27-12-13-29(44)40-34(27)45/h8,10-11,15-16,27H,5-7,9,12-14,17H2,1-4H3,(H,37,46)(H,38,39,41)(H,40,44,45) |
| InChIKey | WXEXNTORLYFMHW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 172.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|