C14H9FN2O4S — CID 155535852
4-fluoro-N-(1,1,3-trioxo-1,2-benzothiazol-6-yl)benzamide (PubChem CID 155535852) has the molecular formula C14H9FN2O4S and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-fluoro-N-(1,1,3-trioxo-1,2-benzothiazol-6-yl)benzamide.
| Compound Name | 4-fluoro-N-(1,1,3-trioxo-1,2-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 155535852 |
| Molecular Formula | C14H9FN2O4S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-fluoro-N-(1,1,3-trioxo-1,2-benzothiazol-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)S(=O)(=O)NC2=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H9FN2O4S/c15-9-3-1-8(2-4-9)13(18)16-10-5-6-11-12(7-10)22(20,21)17-14(11)19/h1-7H,(H,16,18)(H,17,19) |
| InChIKey | OCOFKRDDYHXLRJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |