C24H27NO3 — CID 155535905
7-[(1-benzylpiperidin-4-yl)methoxy]-3,4-dimethylchromen-2-one (PubChem CID 155535905) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 7-[(1-benzylpiperidin-4-yl)methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[(1-benzylpiperidin-4-yl)methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 155535905 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 7-[(1-benzylpiperidin-4-yl)methoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCC3CCN(Cc4ccccc4)CC3)cc2oc1=O |
| InChI | InChI=1S/C24H27NO3/c1-17-18(2)24(26)28-23-14-21(8-9-22(17)23)27-16-20-10-12-25(13-11-20)15-19-6-4-3-5-7-19/h3-9,14,20H,10-13,15-16H2,1-2H3 |
| InChIKey | MWFBGTXYOJLQIW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|