C25H23F2N5OS — CID 155535910
(4aS,8aR)-4-(3,4-difluorophenyl)-2-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 155535910) has the molecular formula C25H23F2N5OS and a molecular weight of 479.56 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-difluorophenyl)-2-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-4-(3,4-difluorophenyl)-2-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 155535910 |
| Molecular Formula | C25H23F2N5OS |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (4aS,8aR)-4-(3,4-difluorophenyl)-2-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | O=C1[C@@H]2CC=CC[C@@H]2C(c2ccc(F)c(F)c2)=NN1C1CCN(c2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C25H23F2N5OS/c26-19-6-5-15(13-20(19)27)22-17-3-1-2-4-18(17)25(33)32(30-22)16-7-10-31(11-8-16)24-23-21(9-12-34-23)28-14-29-24/h1-2,5-6,9,12-14,16-18H,3-4,7-8,10-11H2/t17-,18+/m0/s1 |
| InChIKey | AMTYJRVSCJZKRX-ZWKOTPCHSA-N |
| XLogP | 4.77 |
| TPSA | 61.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|