C30H39Cl2N5O2 — CID 155535996
(2S)-2-amino-3-(1H-indol-3-yl)-N-[5-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]propanamide;dihydrochloride (PubChem CID 155535996) has the molecular formula C30H39Cl2N5O2 and a molecular weight of 572.58 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)-N-[5-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]propanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[5-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 155535996 |
| Molecular Formula | C30H39Cl2N5O2 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[5-[(7-methoxy-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]propanamide;dihydrochloride |
| SMILES | COc1ccc2nc3c(c(NCCCCCNC(=O)[C@@H](N)Cc4c[nH]c5ccccc45)c2c1)CCCC3.Cl.Cl |
| InChI | InChI=1S/C30H37N5O2.2ClH/c1-37-21-13-14-28-24(18-21)29(23-10-4-6-12-27(23)35-28)32-15-7-2-8-16-33-30(36)25(31)17-20-19-34-26-11-5-3-9-22(20)26;;/h3,5,9,11,13-14,18-19,25,34H,2,4,6-8,10,12,15-17,31H2,1H3,(H,32,35)(H,33,36);2*1H/t25-;;/m0../s1 |
| InChIKey | FFQHZQYBYZCMCK-WLOLSGMKSA-N |
| XLogP | 5.72 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|