About (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol
(2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol (PubChem CID 155536011) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol.
Molecular Properties
| Compound Name | (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol |
| PubChem CID | 155536011 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol |
| SMILES | O[C@@H]1CC[C@@](O)(n2c(-c3ccccc3)nc3ncncc32)OC1 |
| InChI | InChI=1S/C16H16N4O3/c21-12-6-7-16(22,23-9-12)20-13-8-17-10-18-14(13)19-15(20)11-4-2-1-3-5-11/h1-5,8,10,12,21-22H,6-7,9H2/t12-,16+/m1/s1 |
| InChIKey | HDBIWXPAOQWNSG-WBMJQRKESA-N |
| XLogP | 1.27 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol?
The IUPAC name of (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol (CID 155536011) is (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol.
What is the SMILES notation for (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol?
The canonical SMILES for (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol is O[C@@H]1CC[C@@](O)(n2c(-c3ccccc3)nc3ncncc32)OC1.
What is the InChIKey of (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol?
The InChIKey is HDBIWXPAOQWNSG-WBMJQRKESA-N. The full InChI is InChI=1S/C16H16N4O3/c21-12-6-7-16(22,23-9-12)20-13-8-17-10-18-14(13)19-15(20)11-4-2-1-3-5-11/h1-5,8,10,12,21-22H,6-7,9H2/t12-,16+/m1/s1.
What are the key properties of (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol?
(2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol has a molecular weight of 312.33 g/mol, XLogP of 1.27, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-(8-phenylpurin-7-yl)oxane-2,5-diol is sourced from PubChem (CID 155536011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).