About 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one
2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one (PubChem CID 155536215) has the molecular formula C18H24N4O
and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one |
| PubChem CID | 155536215 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one |
| SMILES | CCCCCCN1C=NC2C(=O)NC(Cc3ccccc3)=NC21 |
| InChI | InChI=1S/C18H24N4O/c1-2-3-4-8-11-22-13-19-16-17(22)20-15(21-18(16)23)12-14-9-6-5-7-10-14/h5-7,9-10,13,16-17H,2-4,8,11-12H2,1H3,(H,20,21,23) |
| InChIKey | CDNNPPWXTFIBEW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one?
The IUPAC name of 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one (CID 155536215) is 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one.
What is the SMILES notation for 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one?
The canonical SMILES for 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one is CCCCCCN1C=NC2C(=O)NC(Cc3ccccc3)=NC21.
What is the InChIKey of 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one?
The InChIKey is CDNNPPWXTFIBEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O/c1-2-3-4-8-11-22-13-19-16-17(22)20-15(21-18(16)23)12-14-9-6-5-7-10-14/h5-7,9-10,13,16-17H,2-4,8,11-12H2,1H3,(H,20,21,23).
What are the key properties of 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one?
2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one has a molecular weight of 312.42 g/mol, XLogP of 2.38, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-9-hexyl-4,5-dihydro-1H-purin-6-one is sourced from PubChem (CID 155536215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).