C52H58O8 — CID 155536459
[2-benzoyloxy-4-[(1S,3S,9R,11R)-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-8,13-dioxo-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-7-carbonyl]phenyl] benzoate (PubChem CID 155536459) has the molecular formula C52H58O8 and a molecular weight of 811.03 g/mol. Its IUPAC name is [2-benzoyloxy-4-[(1S,3S,9R,11R)-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-8,13-dioxo-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-7-carbonyl]phenyl] benzoate.
| Compound Name | [2-benzoyloxy-4-[(1S,3S,9R,11R)-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-8,13-dioxo-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-7-carbonyl]phenyl] benzoate |
|---|---|
| PubChem CID | 155536459 |
| Molecular Formula | C52H58O8 |
| Molecular Weight | 811.03 g/mol |
| Exact Mass | 810.41 |
| IUPAC Name | [2-benzoyloxy-4-[(1S,3S,9R,11R)-4,4,10,10-tetramethyl-3,9,11-tris(3-methylbut-2-enyl)-8,13-dioxo-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-7-carbonyl]phenyl] benzoate |
| SMILES | CC(C)=CC[C@H]1C[C@@]23C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C(C)C)(C(=O)C(C(=O)c4ccc(OC(=O)c5ccccc5)c(OC(=O)c5ccccc5)c4)=C2OC1(C)C)C3=O |
| InChI | InChI=1S/C52H58O8/c1-32(2)21-24-38-30-51-31-39(25-22-33(3)4)50(9,10)60-45(51)42(44(54)52(48(51)57,49(38,7)8)28-27-34(5)6)43(53)37-23-26-40(58-46(55)35-17-13-11-14-18-35)41(29-37)59-47(56)36-19-15-12-16-20-36/h11-23,26-27,29,38-39H,24-25,28,30-31H2,1-10H3/t38-,39+,51+,52+/m1/s1 |
| InChIKey | ZWRBPVVSVMRSBZ-ZLBDGAJRSA-N |
| XLogP | 11.62 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.03 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|