About ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate
ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate (PubChem CID 155536627) has the molecular formula C24H30O7
and a molecular weight of 430.50 g/mol. Its IUPAC name is ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate |
| PubChem CID | 155536627 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate |
| SMILES | C=C(c1ccc(OC)c(OCCCC(=O)OCC)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H30O7/c1-7-30-23(25)9-8-12-31-20-13-17(10-11-19(20)26-3)16(2)18-14-21(27-4)24(29-6)22(15-18)28-5/h10-11,13-15H,2,7-9,12H2,1,3-6H3 |
| InChIKey | IQASVVJOURHTGV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate?
The IUPAC name of ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate (CID 155536627) is ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate.
What is the SMILES notation for ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate?
The canonical SMILES for ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate is C=C(c1ccc(OC)c(OCCCC(=O)OCC)c1)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate?
The InChIKey is IQASVVJOURHTGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O7/c1-7-30-23(25)9-8-12-31-20-13-17(10-11-19(20)26-3)16(2)18-14-21(27-4)24(29-6)22(15-18)28-5/h10-11,13-15H,2,7-9,12H2,1,3-6H3.
What are the key properties of ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate?
ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate has a molecular weight of 430.50 g/mol, XLogP of 4.50, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]butanoate is sourced from PubChem (CID 155536627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).