C29H24BrN5O4S — CID 155536691
1-[4-[[5-bromo-1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]amino]phenyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 155536691) has the molecular formula C29H24BrN5O4S and a molecular weight of 618.51 g/mol. Its IUPAC name is 1-[4-[[5-bromo-1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]amino]phenyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[4-[[5-bromo-1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]amino]phenyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 155536691 |
| Molecular Formula | C29H24BrN5O4S |
| Molecular Weight | 618.51 g/mol |
| Exact Mass | 617.07 |
| IUPAC Name | 1-[4-[[5-bromo-1-[(4-methylphenyl)methyl]-2-oxoindol-3-ylidene]amino]phenyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | Cc1ccc(CN2C(=O)/C(=N\c3ccc(NC(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C29H24BrN5O4S/c1-18-2-4-19(5-3-18)17-35-26-15-6-20(30)16-25(26)27(28(35)36)32-21-7-9-22(10-8-21)33-29(37)34-23-11-13-24(14-12-23)40(31,38)39/h2-16H,17H2,1H3,(H2,31,38,39)(H2,33,34,37)/b32-27- |
| InChIKey | FVJCCQFNTLHMBJ-MXNGAVTRSA-N |
| XLogP | 5.72 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|