C19H22O6 — CID 155536697
(1S,4R,5S,6R,11S,12R,13R,16S)-4,5,6-trihydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-7,9-dien-18-one (PubChem CID 155536697) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is (1S,4R,5S,6R,11S,12R,13R,16S)-4,5,6-trihydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-7,9-dien-18-one.
| Compound Name | (1S,4R,5S,6R,11S,12R,13R,16S)-4,5,6-trihydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-7,9-dien-18-one |
|---|---|
| PubChem CID | 155536697 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (1S,4R,5S,6R,11S,12R,13R,16S)-4,5,6-trihydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-7,9-dien-18-one |
| SMILES | CC1=C[C@@H](O)[C@H](O)[C@@]2(O)CC[C@]34C(=O)O[C@@H]5C(O[C@H]6C1=C2[C@@H]3[C@@H]56)C4C |
| InChI | InChI=1S/C19H22O6/c1-6-5-8(20)16(21)19(23)4-3-18-7(2)13-15(25-17(18)22)10-11(18)12(19)9(6)14(10)24-13/h5,7-8,10-11,13-16,20-21,23H,3-4H2,1-2H3/t7?,8-,10-,11+,13?,14+,15+,16+,18-,19-/m1/s1 |
| InChIKey | DARDNLURXGMCOI-JKUIBERASA-N |
| XLogP | 0.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |