C28H33N5O3 — CID 155536797
N-[5-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]-2-methylphenyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 155536797) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[5-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]-2-methylphenyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[5-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]-2-methylphenyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155536797 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-[5-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]-2-methylphenyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](CCC2CCCCC2)C(N)=O)cc1NC(=O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H33N5O3/c1-19-12-14-21(27(35)31-24(26(29)34)15-13-20-8-4-2-5-9-20)16-25(19)32-28(36)22-17-30-33(18-22)23-10-6-3-7-11-23/h3,6-7,10-12,14,16-18,20,24H,2,4-5,8-9,13,15H2,1H3,(H2,29,34)(H,31,35)(H,32,36)/t24-/m0/s1 |
| InChIKey | AGUJKUAFJPEJNC-DEOSSOPVSA-N |
| XLogP | 4.38 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |