C29H32N4O2 — CID 155536841
3-(1H-indol-3-yl)-1-[4-[3-(1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione (PubChem CID 155536841) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-1-[4-[3-(1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-1-[4-[3-(1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 155536841 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-(1H-indol-3-yl)-1-[4-[3-(1H-indol-3-yl)piperidin-1-yl]butyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2c[nH]c3ccccc23)C(=O)N1CCCCN1CCCC(c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C29H32N4O2/c34-28-16-23(25-18-31-27-12-4-2-10-22(25)27)29(35)33(28)15-6-5-13-32-14-7-8-20(19-32)24-17-30-26-11-3-1-9-21(24)26/h1-4,9-12,17-18,20,23,30-31H,5-8,13-16,19H2 |
| InChIKey | XYCCNFSNSXYSMF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|