C19H30O4 — CID 155536856
(1S,4S,5R,7S,9R,10S,13S)-7-hydroxy-5-(hydroxymethyl)-5,9,13-trimethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one (PubChem CID 155536856) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is (1S,4S,5R,7S,9R,10S,13S)-7-hydroxy-5-(hydroxymethyl)-5,9,13-trimethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one.
| Compound Name | (1S,4S,5R,7S,9R,10S,13S)-7-hydroxy-5-(hydroxymethyl)-5,9,13-trimethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one |
|---|---|
| PubChem CID | 155536856 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (1S,4S,5R,7S,9R,10S,13S)-7-hydroxy-5-(hydroxymethyl)-5,9,13-trimethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one |
| SMILES | C[C@]12CC[C@@H]3[C@](CC[C@@H]4[C@](C)(CO)C[C@@H](O)C[C@]43C)(C1)OC2=O |
| InChI | InChI=1S/C19H30O4/c1-16-6-4-14-18(3)9-12(21)8-17(2,11-20)13(18)5-7-19(14,10-16)23-15(16)22/h12-14,20-21H,4-11H2,1-3H3/t12-,13-,14+,16+,17+,18-,19+/m1/s1 |
| InChIKey | MZTIRWMPPDNPFV-UETVFZEGSA-N |
| XLogP | 2.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |