About (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine
(E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine (PubChem CID 155536894) has the molecular formula C16H19FN2O4
and a molecular weight of 322.34 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine |
| PubChem CID | 155536894 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ccc2ccc(F)cc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H15FN2.C4H4O4/c1-14(2)7-8-15-6-5-10-3-4-11(13)9-12(10)15;5-3(6)1-2-4(7)8/h3-6,9H,7-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XJDJVUPYWGQYAB-WLHGVMLRSA-N |
| XLogP | 2.05 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine?
The IUPAC name of (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine (CID 155536894) is (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine.
What is the SMILES notation for (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine?
The canonical SMILES for (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine is CN(C)CCn1ccc2ccc(F)cc21.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine?
The InChIKey is XJDJVUPYWGQYAB-WLHGVMLRSA-N. The full InChI is InChI=1S/C12H15FN2.C4H4O4/c1-14(2)7-8-15-6-5-10-3-4-11(13)9-12(10)15;5-3(6)1-2-4(7)8/h3-6,9H,7-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine?
(E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine has a molecular weight of 322.34 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;2-(6-fluoroindol-1-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 155536894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).